C10H13N3OS — CID 116556049
4-amino-1-imidazo[2,1-b][1,3]thiazol-6-ylpentan-2-one (PubChem CID 116556049) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is 4-amino-1-imidazo[2,1-b][1,3]thiazol-6-ylpentan-2-one.
| Compound Name | 4-amino-1-imidazo[2,1-b][1,3]thiazol-6-ylpentan-2-one |
|---|---|
| PubChem CID | 116556049 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 4-amino-1-imidazo[2,1-b][1,3]thiazol-6-ylpentan-2-one |
| SMILES | CC(N)CC(=O)Cc1cn2ccsc2n1 |
| InChI | InChI=1S/C10H13N3OS/c1-7(11)4-9(14)5-8-6-13-2-3-15-10(13)12-8/h2-3,6-7H,4-5,11H2,1H3 |
| InChIKey | PTGMPIYIOMEDJR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |