C11H17N3S — CID 115333412
1-imidazo[2,1-b][1,3]thiazol-6-yl-4-methylpentan-2-amine (PubChem CID 115333412) has the molecular formula C11H17N3S and a molecular weight of 223.34 g/mol. Its IUPAC name is 1-imidazo[2,1-b][1,3]thiazol-6-yl-4-methylpentan-2-amine.
| Compound Name | 1-imidazo[2,1-b][1,3]thiazol-6-yl-4-methylpentan-2-amine |
|---|---|
| PubChem CID | 115333412 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 1-imidazo[2,1-b][1,3]thiazol-6-yl-4-methylpentan-2-amine |
| SMILES | CC(C)CC(N)Cc1cn2ccsc2n1 |
| InChI | InChI=1S/C11H17N3S/c1-8(2)5-9(12)6-10-7-14-3-4-15-11(14)13-10/h3-4,7-9H,5-6,12H2,1-2H3 |
| InChIKey | ZXMMOENPLSCPBS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |