C14H23N3S — CID 105023692
1-imidazo[2,1-b][1,3]thiazol-6-yl-3-propylhexan-2-amine (PubChem CID 105023692) has the molecular formula C14H23N3S and a molecular weight of 265.43 g/mol. Its IUPAC name is 1-imidazo[2,1-b][1,3]thiazol-6-yl-3-propylhexan-2-amine.
| Compound Name | 1-imidazo[2,1-b][1,3]thiazol-6-yl-3-propylhexan-2-amine |
|---|---|
| PubChem CID | 105023692 |
| Molecular Formula | C14H23N3S |
| Molecular Weight | 265.43 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 1-imidazo[2,1-b][1,3]thiazol-6-yl-3-propylhexan-2-amine |
| SMILES | CCCC(CCC)C(N)Cc1cn2ccsc2n1 |
| InChI | InChI=1S/C14H23N3S/c1-3-5-11(6-4-2)13(15)9-12-10-17-7-8-18-14(17)16-12/h7-8,10-11,13H,3-6,9,15H2,1-2H3 |
| InChIKey | SOTHABDQLSPLCC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |