C10H12N2O2S — CID 115333077
1-imidazo[2,1-b][1,3]thiazol-6-yl-4-methoxybutan-2-one (PubChem CID 115333077) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 1-imidazo[2,1-b][1,3]thiazol-6-yl-4-methoxybutan-2-one.
| Compound Name | 1-imidazo[2,1-b][1,3]thiazol-6-yl-4-methoxybutan-2-one |
|---|---|
| PubChem CID | 115333077 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 1-imidazo[2,1-b][1,3]thiazol-6-yl-4-methoxybutan-2-one |
| SMILES | COCCC(=O)Cc1cn2ccsc2n1 |
| InChI | InChI=1S/C10H12N2O2S/c1-14-4-2-9(13)6-8-7-12-3-5-15-10(12)11-8/h3,5,7H,2,4,6H2,1H3 |
| InChIKey | QKTQEEQTZIAYDO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |