C11H11F3N2O2S — CID 103146878
1-imidazo[2,1-b][1,3]thiazol-6-yl-4-(2,2,2-trifluoroethoxy)butan-2-one (PubChem CID 103146878) has the molecular formula C11H11F3N2O2S and a molecular weight of 292.28 g/mol. Its IUPAC name is 1-imidazo[2,1-b][1,3]thiazol-6-yl-4-(2,2,2-trifluoroethoxy)butan-2-one.
| Compound Name | 1-imidazo[2,1-b][1,3]thiazol-6-yl-4-(2,2,2-trifluoroethoxy)butan-2-one |
|---|---|
| PubChem CID | 103146878 |
| Molecular Formula | C11H11F3N2O2S |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 1-imidazo[2,1-b][1,3]thiazol-6-yl-4-(2,2,2-trifluoroethoxy)butan-2-one |
| SMILES | O=C(CCOCC(F)(F)F)Cc1cn2ccsc2n1 |
| InChI | InChI=1S/C11H11F3N2O2S/c12-11(13,14)7-18-3-1-9(17)5-8-6-16-2-4-19-10(16)15-8/h2,4,6H,1,3,5,7H2 |
| InChIKey | UYRVTVQVPIGDCD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|