C14H13N3OS — CID 105123036
1-imidazo[2,1-b][1,3]thiazol-6-yl-4-pyridin-3-ylbutan-2-one (PubChem CID 105123036) has the molecular formula C14H13N3OS and a molecular weight of 271.35 g/mol. Its IUPAC name is 1-imidazo[2,1-b][1,3]thiazol-6-yl-4-pyridin-3-ylbutan-2-one.
| Compound Name | 1-imidazo[2,1-b][1,3]thiazol-6-yl-4-pyridin-3-ylbutan-2-one |
|---|---|
| PubChem CID | 105123036 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 1-imidazo[2,1-b][1,3]thiazol-6-yl-4-pyridin-3-ylbutan-2-one |
| SMILES | O=C(CCc1cccnc1)Cc1cn2ccsc2n1 |
| InChI | InChI=1S/C14H13N3OS/c18-13(4-3-11-2-1-5-15-9-11)8-12-10-17-6-7-19-14(17)16-12/h1-2,5-7,9-10H,3-4,8H2 |
| InChIKey | YALRDHKPCJZSMK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |