2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid

C8H7N3O4S — CID 104571144

IUPAC2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid
SMILESCC(C(=O)O)c1nc2sccn2c1[N+](=O)[O-]
InChIInChI=1S/C8H7N3O4S/c1-4(7(12)13)5-6(11(14)15)10-2-3-16-8(10)9-5/h2-4H,1H3,(H,12,13)
InChIKeyLXXJGQXERJCENA-UHFFFAOYSA-N
MW241.23 g/mol
LogP1.49
Rot. Bonds3

About 2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid

2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid (PubChem CID 104571144) has the molecular formula C8H7N3O4S and a molecular weight of 241.23 g/mol. Its IUPAC name is 2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid.

Molecular Properties

Compound Name2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid
PubChem CID104571144
Molecular FormulaC8H7N3O4S
Molecular Weight241.23 g/mol
Exact Mass241.02
IUPAC Name2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid
SMILESCC(C(=O)O)c1nc2sccn2c1[N+](=O)[O-]
InChIInChI=1S/C8H7N3O4S/c1-4(7(12)13)5-6(11(14)15)10-2-3-16-8(10)9-5/h2-4H,1H3,(H,12,13)
InChIKeyLXXJGQXERJCENA-UHFFFAOYSA-N
XLogP1.49
TPSA97.74 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.23
LogP ≤ 51.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid?
The IUPAC name of 2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid (CID 104571144) is 2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid.
What is the SMILES notation for 2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid?
The canonical SMILES for 2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid is CC(C(=O)O)c1nc2sccn2c1[N+](=O)[O-].
What is the InChIKey of 2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid?
The InChIKey is LXXJGQXERJCENA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O4S/c1-4(7(12)13)5-6(11(14)15)10-2-3-16-8(10)9-5/h2-4H,1H3,(H,12,13).
What are the key properties of 2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid?
2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid has a molecular weight of 241.23 g/mol, XLogP of 1.49, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid is sourced from PubChem (CID 104571144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).