C8H7N3O4S — CID 104571144
2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid (PubChem CID 104571144) has the molecular formula C8H7N3O4S and a molecular weight of 241.23 g/mol. Its IUPAC name is 2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid.
| Compound Name | 2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid |
|---|---|
| PubChem CID | 104571144 |
| Molecular Formula | C8H7N3O4S |
| Molecular Weight | 241.23 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid |
| SMILES | CC(C(=O)O)c1nc2sccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H7N3O4S/c1-4(7(12)13)5-6(11(14)15)10-2-3-16-8(10)9-5/h2-4H,1H3,(H,12,13) |
| InChIKey | LXXJGQXERJCENA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.23 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|