About 3-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)butan-2-amine
3-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)butan-2-amine (PubChem CID 63198309) has the molecular formula C9H12N4O2S
and a molecular weight of 240.29 g/mol. Its IUPAC name is 3-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)butan-2-amine.
Molecular Properties
| Compound Name | 3-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)butan-2-amine |
| PubChem CID | 63198309 |
| Molecular Formula | C9H12N4O2S |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 3-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)butan-2-amine |
| SMILES | CC(N)C(C)c1nc2sccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12N4O2S/c1-5(6(2)10)7-8(13(14)15)12-3-4-16-9(12)11-7/h3-6H,10H2,1-2H3 |
| InChIKey | JFMXJQAYFYVKEB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)butan-2-amine?
The IUPAC name of 3-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)butan-2-amine (CID 63198309) is 3-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)butan-2-amine.
What is the SMILES notation for 3-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)butan-2-amine?
The canonical SMILES for 3-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)butan-2-amine is CC(N)C(C)c1nc2sccn2c1[N+](=O)[O-].
What is the InChIKey of 3-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)butan-2-amine?
The InChIKey is JFMXJQAYFYVKEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O2S/c1-5(6(2)10)7-8(13(14)15)12-3-4-16-9(12)11-7/h3-6H,10H2,1-2H3.
What are the key properties of 3-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)butan-2-amine?
3-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)butan-2-amine has a molecular weight of 240.29 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)butan-2-amine is sourced from PubChem (CID 63198309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).