C6H3N3O3S — CID 10703065
5-nitroimidazo[2,1-b][1,3]thiazole-6-carbaldehyde (PubChem CID 10703065) has the molecular formula C6H3N3O3S and a molecular weight of 197.18 g/mol. Its IUPAC name is 5-nitroimidazo[2,1-b][1,3]thiazole-6-carbaldehyde.
| Compound Name | 5-nitroimidazo[2,1-b][1,3]thiazole-6-carbaldehyde |
|---|---|
| PubChem CID | 10703065 |
| Molecular Formula | C6H3N3O3S |
| Molecular Weight | 197.18 g/mol |
| Exact Mass | 196.99 |
| IUPAC Name | 5-nitroimidazo[2,1-b][1,3]thiazole-6-carbaldehyde |
| SMILES | O=Cc1nc2sccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H3N3O3S/c10-3-4-5(9(11)12)8-1-2-13-6(8)7-4/h1-3H |
| InChIKey | ZVMHKNLKJJRBJT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.18 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|