C9H6N4O2S3 — CID 18095379
6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitroimidazo[2,1-b][1,3]thiazole (PubChem CID 18095379) has the molecular formula C9H6N4O2S3 and a molecular weight of 298.37 g/mol. Its IUPAC name is 6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 18095379 |
| Molecular Formula | C9H6N4O2S3 |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 297.97 |
| IUPAC Name | 6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitroimidazo[2,1-b][1,3]thiazole |
| SMILES | Cc1csc(Sc2nc3sccn3c2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C9H6N4O2S3/c1-5-4-17-9(10-5)18-6-7(13(14)15)12-2-3-16-8(12)11-6/h2-4H,1H3 |
| InChIKey | HNMPDDHAKNOBGR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|