C11H13N7O2S2 — CID 133344909
2-[4-ethyl-5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)sulfanyl-1,2,4-triazol-3-yl]ethanamine (PubChem CID 133344909) has the molecular formula C11H13N7O2S2 and a molecular weight of 339.41 g/mol. Its IUPAC name is 2-[4-ethyl-5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)sulfanyl-1,2,4-triazol-3-yl]ethanamine.
| Compound Name | 2-[4-ethyl-5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)sulfanyl-1,2,4-triazol-3-yl]ethanamine |
|---|---|
| PubChem CID | 133344909 |
| Molecular Formula | C11H13N7O2S2 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 2-[4-ethyl-5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)sulfanyl-1,2,4-triazol-3-yl]ethanamine |
| SMILES | CCn1c(CCN)nnc1Sc1nc2sccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13N7O2S2/c1-2-16-7(3-4-12)14-15-11(16)22-8-9(18(19)20)17-5-6-21-10(17)13-8/h5-6H,2-4,12H2,1H3 |
| InChIKey | NDQJZBAWLHDEFK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|