About 2-[1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)imidazol-2-yl]ethanamine
2-[1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)imidazol-2-yl]ethanamine (PubChem CID 55071962) has the molecular formula C10H10N6O2S
and a molecular weight of 278.30 g/mol. Its IUPAC name is 2-[1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)imidazol-2-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)imidazol-2-yl]ethanamine |
| PubChem CID | 55071962 |
| Molecular Formula | C10H10N6O2S |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 2-[1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)imidazol-2-yl]ethanamine |
| SMILES | NCCc1nccn1-c1nc2sccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N6O2S/c11-2-1-7-12-3-4-14(7)8-9(16(17)18)15-5-6-19-10(15)13-8/h3-6H,1-2,11H2 |
| InChIKey | USRWJJZEKHZLPY-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)imidazol-2-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)imidazol-2-yl]ethanamine?
The IUPAC name of 2-[1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)imidazol-2-yl]ethanamine (CID 55071962) is 2-[1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)imidazol-2-yl]ethanamine.
What is the SMILES notation for 2-[1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)imidazol-2-yl]ethanamine?
The canonical SMILES for 2-[1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)imidazol-2-yl]ethanamine is NCCc1nccn1-c1nc2sccn2c1[N+](=O)[O-].
What is the InChIKey of 2-[1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)imidazol-2-yl]ethanamine?
The InChIKey is USRWJJZEKHZLPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N6O2S/c11-2-1-7-12-3-4-14(7)8-9(16(17)18)15-5-6-19-10(15)13-8/h3-6H,1-2,11H2.
What are the key properties of 2-[1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)imidazol-2-yl]ethanamine?
2-[1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)imidazol-2-yl]ethanamine has a molecular weight of 278.30 g/mol, XLogP of 0.99, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)imidazol-2-yl]ethanamine is sourced from PubChem (CID 55071962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).