C14H11N5O2S — CID 18095526
6-(5,6-dimethylbenzimidazol-1-yl)-5-nitroimidazo[2,1-b][1,3]thiazole (PubChem CID 18095526) has the molecular formula C14H11N5O2S and a molecular weight of 313.34 g/mol. Its IUPAC name is 6-(5,6-dimethylbenzimidazol-1-yl)-5-nitroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-(5,6-dimethylbenzimidazol-1-yl)-5-nitroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 18095526 |
| Molecular Formula | C14H11N5O2S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 6-(5,6-dimethylbenzimidazol-1-yl)-5-nitroimidazo[2,1-b][1,3]thiazole |
| SMILES | Cc1cc2ncn(-c3nc4sccn4c3[N+](=O)[O-])c2cc1C |
| InChI | InChI=1S/C14H11N5O2S/c1-8-5-10-11(6-9(8)2)18(7-15-10)12-13(19(20)21)17-3-4-22-14(17)16-12/h3-7H,1-2H3 |
| InChIKey | FHEGGFONKZKUKK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|