C11H15N5O2S — CID 115313596
2-methyl-1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)piperidin-4-amine (PubChem CID 115313596) has the molecular formula C11H15N5O2S and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-methyl-1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)piperidin-4-amine.
| Compound Name | 2-methyl-1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 115313596 |
| Molecular Formula | C11H15N5O2S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2-methyl-1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)piperidin-4-amine |
| SMILES | CC1CC(N)CCN1c1nc2sccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15N5O2S/c1-7-6-8(12)2-3-14(7)9-10(16(17)18)15-4-5-19-11(15)13-9/h4-5,7-8H,2-3,6,12H2,1H3 |
| InChIKey | VJLLXLQQRSYGCZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|