C13H19N5O2S — CID 80546147
N-[[1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)piperidin-4-yl]methyl]ethanamine (PubChem CID 80546147) has the molecular formula C13H19N5O2S and a molecular weight of 309.39 g/mol. Its IUPAC name is N-[[1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)piperidin-4-yl]methyl]ethanamine.
| Compound Name | N-[[1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)piperidin-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 80546147 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-[[1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)piperidin-4-yl]methyl]ethanamine |
| SMILES | CCNCC1CCN(c2nc3sccn3c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C13H19N5O2S/c1-2-14-9-10-3-5-16(6-4-10)11-12(18(19)20)17-7-8-21-13(17)15-11/h7-8,10,14H,2-6,9H2,1H3 |
| InChIKey | PRHMVTZPSRIJDF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|