C17H16Cl2N4O3S — CID 133363083
6-[4-[(3,4-dichlorophenyl)methoxy]piperidin-1-yl]-5-nitroimidazo[2,1-b][1,3]thiazole (PubChem CID 133363083) has the molecular formula C17H16Cl2N4O3S and a molecular weight of 427.31 g/mol. Its IUPAC name is 6-[4-[(3,4-dichlorophenyl)methoxy]piperidin-1-yl]-5-nitroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-[4-[(3,4-dichlorophenyl)methoxy]piperidin-1-yl]-5-nitroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 133363083 |
| Molecular Formula | C17H16Cl2N4O3S |
| Molecular Weight | 427.31 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 6-[4-[(3,4-dichlorophenyl)methoxy]piperidin-1-yl]-5-nitroimidazo[2,1-b][1,3]thiazole |
| SMILES | O=[N+]([O-])c1c(N2CCC(OCc3ccc(Cl)c(Cl)c3)CC2)nc2sccn12 |
| InChI | InChI=1S/C17H16Cl2N4O3S/c18-13-2-1-11(9-14(13)19)10-26-12-3-5-21(6-4-12)15-16(23(24)25)22-7-8-27-17(22)20-15/h1-2,7-9,12H,3-6,10H2 |
| InChIKey | JIEZLZSDPBBXEC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.31 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|