C17H16N6O2S3 — CID 24606974
5-nitro-6-[4-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]imidazo[2,1-b][1,3]thiazole (PubChem CID 24606974) has the molecular formula C17H16N6O2S3 and a molecular weight of 432.56 g/mol. Its IUPAC name is 5-nitro-6-[4-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]imidazo[2,1-b][1,3]thiazole.
| Compound Name | 5-nitro-6-[4-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 24606974 |
| Molecular Formula | C17H16N6O2S3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 5-nitro-6-[4-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]imidazo[2,1-b][1,3]thiazole |
| SMILES | O=[N+]([O-])c1c(N2CCN(Cc3csc(-c4ccsc4)n3)CC2)nc2sccn12 |
| InChI | InChI=1S/C17H16N6O2S3/c24-23(25)16-14(19-17-22(16)6-8-27-17)21-4-2-20(3-5-21)9-13-11-28-15(18-13)12-1-7-26-10-12/h1,6-8,10-11H,2-5,9H2 |
| InChIKey | FZPMHLIDWMFTTQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|