C14H15F2N7O2S — CID 133276329
6-[4-[[1-(difluoromethyl)imidazol-2-yl]methyl]piperazin-1-yl]-5-nitroimidazo[2,1-b][1,3]thiazole (PubChem CID 133276329) has the molecular formula C14H15F2N7O2S and a molecular weight of 383.38 g/mol. Its IUPAC name is 6-[4-[[1-(difluoromethyl)imidazol-2-yl]methyl]piperazin-1-yl]-5-nitroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-[4-[[1-(difluoromethyl)imidazol-2-yl]methyl]piperazin-1-yl]-5-nitroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 133276329 |
| Molecular Formula | C14H15F2N7O2S |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 6-[4-[[1-(difluoromethyl)imidazol-2-yl]methyl]piperazin-1-yl]-5-nitroimidazo[2,1-b][1,3]thiazole |
| SMILES | O=[N+]([O-])c1c(N2CCN(Cc3nccn3C(F)F)CC2)nc2sccn12 |
| InChI | InChI=1S/C14H15F2N7O2S/c15-13(16)21-2-1-17-10(21)9-19-3-5-20(6-4-19)11-12(23(24)25)22-7-8-26-14(22)18-11/h1-2,7-8,13H,3-6,9H2 |
| InChIKey | CGQIGRHQGQOADV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|