C16H21N5O3S — CID 99251972
cyclohexyl-[4-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)piperazin-1-yl]methanone (PubChem CID 99251972) has the molecular formula C16H21N5O3S and a molecular weight of 363.44 g/mol. Its IUPAC name is cyclohexyl-[4-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)piperazin-1-yl]methanone.
| Compound Name | cyclohexyl-[4-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 99251972 |
| Molecular Formula | C16H21N5O3S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | cyclohexyl-[4-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)piperazin-1-yl]methanone |
| SMILES | O=C(C1CCCCC1)N1CCN(c2nc3sccn3c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C16H21N5O3S/c22-15(12-4-2-1-3-5-12)19-8-6-18(7-9-19)13-14(21(23)24)20-10-11-25-16(20)17-13/h10-12H,1-9H2 |
| InChIKey | QGXNDHJVULMILJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|