C16H23N5O3S — CID 49431524
1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)-N-pentan-2-ylpiperidine-3-carboxamide (PubChem CID 49431524) has the molecular formula C16H23N5O3S and a molecular weight of 365.46 g/mol. Its IUPAC name is 1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)-N-pentan-2-ylpiperidine-3-carboxamide.
| Compound Name | 1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)-N-pentan-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 49431524 |
| Molecular Formula | C16H23N5O3S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)-N-pentan-2-ylpiperidine-3-carboxamide |
| SMILES | CCCC(C)NC(=O)C1CCCN(c2nc3sccn3c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C16H23N5O3S/c1-3-5-11(2)17-14(22)12-6-4-7-19(10-12)13-15(21(23)24)20-8-9-25-16(20)18-13/h8-9,11-12H,3-7,10H2,1-2H3,(H,17,22) |
| InChIKey | BJOXPWZKUXZRPC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|