C15H17N7O2S — CID 133422956
6-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidin-1-yl]-5-nitroimidazo[2,1-b][1,3]thiazole (PubChem CID 133422956) has the molecular formula C15H17N7O2S and a molecular weight of 359.42 g/mol. Its IUPAC name is 6-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidin-1-yl]-5-nitroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidin-1-yl]-5-nitroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 133422956 |
| Molecular Formula | C15H17N7O2S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 6-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidin-1-yl]-5-nitroimidazo[2,1-b][1,3]thiazole |
| SMILES | O=[N+]([O-])c1c(N2CCCC(c3nncn3C3CC3)C2)nc2sccn12 |
| InChI | InChI=1S/C15H17N7O2S/c23-22(24)14-13(17-15-20(14)6-7-25-15)19-5-1-2-10(8-19)12-18-16-9-21(12)11-3-4-11/h6-7,9-11H,1-5,8H2 |
| InChIKey | KMYVWKUOKURTSF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|