C13H16N4O4S — CID 51245763
ethyl 1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)piperidine-4-carboxylate (PubChem CID 51245763) has the molecular formula C13H16N4O4S and a molecular weight of 324.36 g/mol. Its IUPAC name is ethyl 1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 51245763 |
| Molecular Formula | C13H16N4O4S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | ethyl 1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2nc3sccn3c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C13H16N4O4S/c1-2-21-12(18)9-3-5-15(6-4-9)10-11(17(19)20)16-7-8-22-13(16)14-10/h7-9H,2-6H2,1H3 |
| InChIKey | NUSVKSWAVMXZBU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|