C19H20N4O4S3 — CID 24656779
4-[[4-(4-methyl-3-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-2-thiophen-3-yl-1,3-thiazole (PubChem CID 24656779) has the molecular formula C19H20N4O4S3 and a molecular weight of 464.59 g/mol. Its IUPAC name is 4-[[4-(4-methyl-3-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-2-thiophen-3-yl-1,3-thiazole.
| Compound Name | 4-[[4-(4-methyl-3-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-2-thiophen-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 24656779 |
| Molecular Formula | C19H20N4O4S3 |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | 4-[[4-(4-methyl-3-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-2-thiophen-3-yl-1,3-thiazole |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(Cc3csc(-c4ccsc4)n3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H20N4O4S3/c1-14-2-3-17(10-18(14)23(24)25)30(26,27)22-7-5-21(6-8-22)11-16-13-29-19(20-16)15-4-9-28-12-15/h2-4,9-10,12-13H,5-8,11H2,1H3 |
| InChIKey | WEOCNVSOMFWZPR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 96.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|