C16H16N4O2S — CID 94438283
6-[(2R)-2-(2-methylphenyl)pyrrolidin-1-yl]-5-nitroimidazo[2,1-b][1,3]thiazole (PubChem CID 94438283) has the molecular formula C16H16N4O2S and a molecular weight of 328.40 g/mol. Its IUPAC name is 6-[(2R)-2-(2-methylphenyl)pyrrolidin-1-yl]-5-nitroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-[(2R)-2-(2-methylphenyl)pyrrolidin-1-yl]-5-nitroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 94438283 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 6-[(2R)-2-(2-methylphenyl)pyrrolidin-1-yl]-5-nitroimidazo[2,1-b][1,3]thiazole |
| SMILES | Cc1ccccc1[C@H]1CCCN1c1nc2sccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16N4O2S/c1-11-5-2-3-6-12(11)13-7-4-8-18(13)14-15(20(21)22)19-9-10-23-16(19)17-14/h2-3,5-6,9-10,13H,4,7-8H2,1H3/t13-/m1/s1 |
| InChIKey | IPQYTQCNABHLAW-CYBMUJFWSA-N |
| XLogP | 3.95 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|