C17H25N5O4S — CID 133397126
tert-butyl N-[[3-methyl-1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)piperidin-2-yl]methyl]carbamate (PubChem CID 133397126) has the molecular formula C17H25N5O4S and a molecular weight of 395.49 g/mol. Its IUPAC name is tert-butyl N-[[3-methyl-1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)piperidin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-methyl-1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)piperidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 133397126 |
| Molecular Formula | C17H25N5O4S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | tert-butyl N-[[3-methyl-1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)piperidin-2-yl]methyl]carbamate |
| SMILES | CC1CCCN(c2nc3sccn3c2[N+](=O)[O-])C1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H25N5O4S/c1-11-6-5-7-20(12(11)10-18-16(23)26-17(2,3)4)13-14(22(24)25)21-8-9-27-15(21)19-13/h8-9,11-12H,5-7,10H2,1-4H3,(H,18,23) |
| InChIKey | ZRFZXYHAVRMLDO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|