C18H26N6O4 — CID 71847656
tert-butyl N-[[4-methyl-1-(3-nitroimidazo[1,2-a]pyridin-2-yl)piperazin-2-yl]methyl]carbamate (PubChem CID 71847656) has the molecular formula C18H26N6O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is tert-butyl N-[[4-methyl-1-(3-nitroimidazo[1,2-a]pyridin-2-yl)piperazin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-methyl-1-(3-nitroimidazo[1,2-a]pyridin-2-yl)piperazin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 71847656 |
| Molecular Formula | C18H26N6O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | tert-butyl N-[[4-methyl-1-(3-nitroimidazo[1,2-a]pyridin-2-yl)piperazin-2-yl]methyl]carbamate |
| SMILES | CN1CCN(c2nc3ccccn3c2[N+](=O)[O-])C(CNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H26N6O4/c1-18(2,3)28-17(25)19-11-13-12-21(4)9-10-22(13)15-16(24(26)27)23-8-6-5-7-14(23)20-15/h5-8,13H,9-12H2,1-4H3,(H,19,25) |
| InChIKey | XOMCEAZQCYHLRD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|