C15H16F3N5O3 — CID 100626150
(3R)-1-(3-nitroimidazo[1,2-a]pyridin-2-yl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide (PubChem CID 100626150) has the molecular formula C15H16F3N5O3 and a molecular weight of 371.32 g/mol. Its IUPAC name is (3R)-1-(3-nitroimidazo[1,2-a]pyridin-2-yl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(3-nitroimidazo[1,2-a]pyridin-2-yl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 100626150 |
| Molecular Formula | C15H16F3N5O3 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | (3R)-1-(3-nitroimidazo[1,2-a]pyridin-2-yl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCC(F)(F)F)[C@@H]1CCCN(c2nc3ccccn3c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C15H16F3N5O3/c16-15(17,18)9-19-13(24)10-4-3-6-21(8-10)12-14(23(25)26)22-7-2-1-5-11(22)20-12/h1-2,5,7,10H,3-4,6,8-9H2,(H,19,24)/t10-/m1/s1 |
| InChIKey | FVVVGDQIPHGXSY-SNVBAGLBSA-N |
| XLogP | 2.14 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|