C16H17F3N4O — CID 133326896
1-quinazolin-4-yl-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide (PubChem CID 133326896) has the molecular formula C16H17F3N4O and a molecular weight of 338.33 g/mol. Its IUPAC name is 1-quinazolin-4-yl-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide.
| Compound Name | 1-quinazolin-4-yl-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133326896 |
| Molecular Formula | C16H17F3N4O |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-quinazolin-4-yl-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1CCCN(c2ncnc3ccccc23)C1 |
| InChI | InChI=1S/C16H17F3N4O/c17-16(18,19)9-20-15(24)11-4-3-7-23(8-11)14-12-5-1-2-6-13(12)21-10-22-14/h1-2,5-6,10-11H,3-4,7-9H2,(H,20,24) |
| InChIKey | TXCAJTNQXMDMTG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |