C19H22F3N3O — CID 133402580
1-(2-ethylquinolin-4-yl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide (PubChem CID 133402580) has the molecular formula C19H22F3N3O and a molecular weight of 365.40 g/mol. Its IUPAC name is 1-(2-ethylquinolin-4-yl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide.
| Compound Name | 1-(2-ethylquinolin-4-yl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133402580 |
| Molecular Formula | C19H22F3N3O |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 1-(2-ethylquinolin-4-yl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
| SMILES | CCc1cc(N2CCCC(C(=O)NCC(F)(F)F)C2)c2ccccc2n1 |
| InChI | InChI=1S/C19H22F3N3O/c1-2-14-10-17(15-7-3-4-8-16(15)24-14)25-9-5-6-13(11-25)18(26)23-12-19(20,21)22/h3-4,7-8,10,13H,2,5-6,9,11-12H2,1H3,(H,23,26) |
| InChIKey | WTOCUGZNVUTQBI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |