C21H29N3O2 — CID 133400609
tert-butyl N-[1-(2-ethylquinolin-4-yl)piperidin-4-yl]carbamate (PubChem CID 133400609) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is tert-butyl N-[1-(2-ethylquinolin-4-yl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2-ethylquinolin-4-yl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 133400609 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | tert-butyl N-[1-(2-ethylquinolin-4-yl)piperidin-4-yl]carbamate |
| SMILES | CCc1cc(N2CCC(NC(=O)OC(C)(C)C)CC2)c2ccccc2n1 |
| InChI | InChI=1S/C21H29N3O2/c1-5-15-14-19(17-8-6-7-9-18(17)22-15)24-12-10-16(11-13-24)23-20(25)26-21(2,3)4/h6-9,14,16H,5,10-13H2,1-4H3,(H,23,25) |
| InChIKey | KQEBTRHYRNOSKH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |