C17H23N5O — CID 166600895
N-tert-butyl-1-pyrido[3,4-d]pyrimidin-4-ylpiperidine-3-carboxamide (PubChem CID 166600895) has the molecular formula C17H23N5O and a molecular weight of 313.40 g/mol. Its IUPAC name is N-tert-butyl-1-pyrido[3,4-d]pyrimidin-4-ylpiperidine-3-carboxamide.
| Compound Name | N-tert-butyl-1-pyrido[3,4-d]pyrimidin-4-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 166600895 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | N-tert-butyl-1-pyrido[3,4-d]pyrimidin-4-ylpiperidine-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1CCCN(c2ncnc3cnccc23)C1 |
| InChI | InChI=1S/C17H23N5O/c1-17(2,3)21-16(23)12-5-4-8-22(10-12)15-13-6-7-18-9-14(13)19-11-20-15/h6-7,9,11-12H,4-5,8,10H2,1-3H3,(H,21,23) |
| InChIKey | HJEXYFXSIFMUAX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |