C18H23N5O2 — CID 110436261
N-(3-formamidopropyl)-1-quinazolin-4-ylpiperidine-3-carboxamide (PubChem CID 110436261) has the molecular formula C18H23N5O2 and a molecular weight of 341.41 g/mol. Its IUPAC name is N-(3-formamidopropyl)-1-quinazolin-4-ylpiperidine-3-carboxamide.
| Compound Name | N-(3-formamidopropyl)-1-quinazolin-4-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 110436261 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | N-(3-formamidopropyl)-1-quinazolin-4-ylpiperidine-3-carboxamide |
| SMILES | O=CNCCCNC(=O)C1CCCN(c2ncnc3ccccc23)C1 |
| InChI | InChI=1S/C18H23N5O2/c24-13-19-8-4-9-20-18(25)14-5-3-10-23(11-14)17-15-6-1-2-7-16(15)21-12-22-17/h1-2,6-7,12-14H,3-5,8-11H2,(H,19,24)(H,20,25) |
| InChIKey | CNUKFDCSTSAZPC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|