C16H20N4O3S — CID 119352886
4-[(1-thieno[2,3-d]pyrimidin-4-ylpiperidine-3-carbonyl)amino]butanoic acid (PubChem CID 119352886) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is 4-[(1-thieno[2,3-d]pyrimidin-4-ylpiperidine-3-carbonyl)amino]butanoic acid.
| Compound Name | 4-[(1-thieno[2,3-d]pyrimidin-4-ylpiperidine-3-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 119352886 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 4-[(1-thieno[2,3-d]pyrimidin-4-ylpiperidine-3-carbonyl)amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)C1CCCN(c2ncnc3sccc23)C1 |
| InChI | InChI=1S/C16H20N4O3S/c21-13(22)4-1-6-17-15(23)11-3-2-7-20(9-11)14-12-5-8-24-16(12)19-10-18-14/h5,8,10-11H,1-4,6-7,9H2,(H,17,23)(H,21,22) |
| InChIKey | OVEARZWFGUSFRV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|