C18H19N5OS — CID 167778225
N-(4-aminophenyl)-1-thieno[2,3-d]pyrimidin-4-ylpiperidine-3-carboxamide (PubChem CID 167778225) has the molecular formula C18H19N5OS and a molecular weight of 353.45 g/mol. Its IUPAC name is N-(4-aminophenyl)-1-thieno[2,3-d]pyrimidin-4-ylpiperidine-3-carboxamide.
| Compound Name | N-(4-aminophenyl)-1-thieno[2,3-d]pyrimidin-4-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 167778225 |
| Molecular Formula | C18H19N5OS |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | N-(4-aminophenyl)-1-thieno[2,3-d]pyrimidin-4-ylpiperidine-3-carboxamide |
| SMILES | Nc1ccc(NC(=O)C2CCCN(c3ncnc4sccc34)C2)cc1 |
| InChI | InChI=1S/C18H19N5OS/c19-13-3-5-14(6-4-13)22-17(24)12-2-1-8-23(10-12)16-15-7-9-25-18(15)21-11-20-16/h3-7,9,11-12H,1-2,8,10,19H2,(H,22,24) |
| InChIKey | UUJJAJIIPLHMMD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|