C18H24N6O3 — CID 35416947
2-[4-(3-nitroimidazo[1,2-a]pyridin-2-yl)-1,4-diazepan-1-yl]-1-pyrrolidin-1-ylethanone (PubChem CID 35416947) has the molecular formula C18H24N6O3 and a molecular weight of 372.43 g/mol. Its IUPAC name is 2-[4-(3-nitroimidazo[1,2-a]pyridin-2-yl)-1,4-diazepan-1-yl]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[4-(3-nitroimidazo[1,2-a]pyridin-2-yl)-1,4-diazepan-1-yl]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 35416947 |
| Molecular Formula | C18H24N6O3 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 2-[4-(3-nitroimidazo[1,2-a]pyridin-2-yl)-1,4-diazepan-1-yl]-1-pyrrolidin-1-ylethanone |
| SMILES | O=C(CN1CCCN(c2nc3ccccn3c2[N+](=O)[O-])CC1)N1CCCC1 |
| InChI | InChI=1S/C18H24N6O3/c25-16(21-8-3-4-9-21)14-20-7-5-10-22(13-12-20)17-18(24(26)27)23-11-2-1-6-15(23)19-17/h1-2,6,11H,3-5,7-10,12-14H2 |
| InChIKey | DLVFHDICCJVRMO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|