C17H23N5O5 — CID 35416858
2-[4-(2,4-dinitrophenyl)-1,4-diazepan-1-yl]-1-pyrrolidin-1-ylethanone (PubChem CID 35416858) has the molecular formula C17H23N5O5 and a molecular weight of 377.40 g/mol. Its IUPAC name is 2-[4-(2,4-dinitrophenyl)-1,4-diazepan-1-yl]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[4-(2,4-dinitrophenyl)-1,4-diazepan-1-yl]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 35416858 |
| Molecular Formula | C17H23N5O5 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 2-[4-(2,4-dinitrophenyl)-1,4-diazepan-1-yl]-1-pyrrolidin-1-ylethanone |
| SMILES | O=C(CN1CCCN(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CC1)N1CCCC1 |
| InChI | InChI=1S/C17H23N5O5/c23-17(20-7-1-2-8-20)13-18-6-3-9-19(11-10-18)15-5-4-14(21(24)25)12-16(15)22(26)27/h4-5,12H,1-3,6-11,13H2 |
| InChIKey | XFLRLZQSJUBISV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 113.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|