C13H18N4O5 — CID 133486152
(2R)-1-[4-(2,4-dinitrophenyl)piperazin-1-yl]propan-2-ol (PubChem CID 133486152) has the molecular formula C13H18N4O5 and a molecular weight of 310.31 g/mol. Its IUPAC name is (2R)-1-[4-(2,4-dinitrophenyl)piperazin-1-yl]propan-2-ol.
| Compound Name | (2R)-1-[4-(2,4-dinitrophenyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 133486152 |
| Molecular Formula | C13H18N4O5 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | (2R)-1-[4-(2,4-dinitrophenyl)piperazin-1-yl]propan-2-ol |
| SMILES | C[C@@H](O)CN1CCN(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C13H18N4O5/c1-10(18)9-14-4-6-15(7-5-14)12-3-2-11(16(19)20)8-13(12)17(21)22/h2-3,8,10,18H,4-7,9H2,1H3/t10-/m1/s1 |
| InChIKey | TXXBRCWWMXWDHW-SNVBAGLBSA-N |
| XLogP | 1.01 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|