C12H16N4O5 — CID 133313060
[4-amino-1-(2,4-dinitrophenyl)piperidin-4-yl]methanol (PubChem CID 133313060) has the molecular formula C12H16N4O5 and a molecular weight of 296.28 g/mol. Its IUPAC name is [4-amino-1-(2,4-dinitrophenyl)piperidin-4-yl]methanol.
| Compound Name | [4-amino-1-(2,4-dinitrophenyl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 133313060 |
| Molecular Formula | C12H16N4O5 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | [4-amino-1-(2,4-dinitrophenyl)piperidin-4-yl]methanol |
| SMILES | NC1(CO)CCN(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C12H16N4O5/c13-12(8-17)3-5-14(6-4-12)10-2-1-9(15(18)19)7-11(10)16(20)21/h1-2,7,17H,3-6,8,13H2 |
| InChIKey | VKSXRGFTVVLXSA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 135.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|