C18H26N4O4 — CID 55828375
1-[[1-(2,4-dinitrophenyl)piperidin-4-yl]methyl]azepane (PubChem CID 55828375) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is 1-[[1-(2,4-dinitrophenyl)piperidin-4-yl]methyl]azepane.
| Compound Name | 1-[[1-(2,4-dinitrophenyl)piperidin-4-yl]methyl]azepane |
|---|---|
| PubChem CID | 55828375 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 1-[[1-(2,4-dinitrophenyl)piperidin-4-yl]methyl]azepane |
| SMILES | O=[N+]([O-])c1ccc(N2CCC(CN3CCCCCC3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H26N4O4/c23-21(24)16-5-6-17(18(13-16)22(25)26)20-11-7-15(8-12-20)14-19-9-3-1-2-4-10-19/h5-6,13,15H,1-4,7-12,14H2 |
| InChIKey | MXBRMPWVCJWAAH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|