C17H23FN4O3 — CID 134060097
2-[4-(4-fluoro-2-nitrophenyl)-1,4-diazepan-1-yl]-1-pyrrolidin-1-ylethanone (PubChem CID 134060097) has the molecular formula C17H23FN4O3 and a molecular weight of 350.39 g/mol. Its IUPAC name is 2-[4-(4-fluoro-2-nitrophenyl)-1,4-diazepan-1-yl]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[4-(4-fluoro-2-nitrophenyl)-1,4-diazepan-1-yl]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 134060097 |
| Molecular Formula | C17H23FN4O3 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 2-[4-(4-fluoro-2-nitrophenyl)-1,4-diazepan-1-yl]-1-pyrrolidin-1-ylethanone |
| SMILES | O=C(CN1CCCN(c2ccc(F)cc2[N+](=O)[O-])CC1)N1CCCC1 |
| InChI | InChI=1S/C17H23FN4O3/c18-14-4-5-15(16(12-14)22(24)25)20-9-3-6-19(10-11-20)13-17(23)21-7-1-2-8-21/h4-5,12H,1-3,6-11,13H2 |
| InChIKey | APTHLDDXJFELLO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 69.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|