C8H9N3O3S2 — CID 115659063
2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylpropan-1-ol (PubChem CID 115659063) has the molecular formula C8H9N3O3S2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylpropan-1-ol.
| Compound Name | 2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylpropan-1-ol |
|---|---|
| PubChem CID | 115659063 |
| Molecular Formula | C8H9N3O3S2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | 2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylpropan-1-ol |
| SMILES | CC(CO)Sc1nc2sccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H9N3O3S2/c1-5(4-12)16-6-7(11(13)14)10-2-3-15-8(10)9-6/h2-3,5,12H,4H2,1H3 |
| InChIKey | CEUDRZMPHKZTRK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|