C7H5N3O4S2 — CID 3741324
2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetic acid (PubChem CID 3741324) has the molecular formula C7H5N3O4S2 and a molecular weight of 259.27 g/mol. Its IUPAC name is 2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetic acid.
| Compound Name | 2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetic acid |
|---|---|
| PubChem CID | 3741324 |
| Molecular Formula | C7H5N3O4S2 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 258.97 |
| IUPAC Name | 2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetic acid |
| SMILES | O=C(O)CSc1nc2sccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H5N3O4S2/c11-4(12)3-16-5-6(10(13)14)9-1-2-15-7(9)8-5/h1-2H,3H2,(H,11,12) |
| InChIKey | QSZAKNCBDCGECQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|