C11H7N3O3S2 — CID 54911188
4-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylphenol (PubChem CID 54911188) has the molecular formula C11H7N3O3S2 and a molecular weight of 293.33 g/mol. Its IUPAC name is 4-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylphenol.
| Compound Name | 4-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylphenol |
|---|---|
| PubChem CID | 54911188 |
| Molecular Formula | C11H7N3O3S2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | 4-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylphenol |
| SMILES | O=[N+]([O-])c1c(Sc2ccc(O)cc2)nc2sccn12 |
| InChI | InChI=1S/C11H7N3O3S2/c15-7-1-3-8(4-2-7)19-9-10(14(16)17)13-5-6-18-11(13)12-9/h1-6,15H |
| InChIKey | PIUKPFLCXRELQQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|