C14H11N3O4S2 — CID 18095457
6-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)-5-nitroimidazo[2,1-b][1,3]thiazole (PubChem CID 18095457) has the molecular formula C14H11N3O4S2 and a molecular weight of 349.39 g/mol. Its IUPAC name is 6-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)-5-nitroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)-5-nitroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 18095457 |
| Molecular Formula | C14H11N3O4S2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | 6-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)-5-nitroimidazo[2,1-b][1,3]thiazole |
| SMILES | O=[N+]([O-])c1c(Sc2ccc3c(c2)OCCCO3)nc2sccn12 |
| InChI | InChI=1S/C14H11N3O4S2/c18-17(19)13-12(15-14-16(13)4-7-22-14)23-9-2-3-10-11(8-9)21-6-1-5-20-10/h2-4,7-8H,1,5-6H2 |
| InChIKey | HUXUHJLOKXHHPE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|