C14H12N4O4S — CID 18095773
N-(1,3-benzodioxol-5-ylmethyl)-N-methyl-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 18095773) has the molecular formula C14H12N4O4S and a molecular weight of 332.34 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-methyl-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-methyl-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 18095773 |
| Molecular Formula | C14H12N4O4S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-methyl-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | CN(Cc1ccc2c(c1)OCO2)c1nc2sccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12N4O4S/c1-16(7-9-2-3-10-11(6-9)22-8-21-10)12-13(18(19)20)17-4-5-23-14(17)15-12/h2-6H,7-8H2,1H3 |
| InChIKey | LUDKSFATVWGMKV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|