C15H17N7O2S — CID 86902705
N-methyl-5-nitro-N-[(1-pyridazin-3-ylpyrrolidin-2-yl)methyl]imidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 86902705) has the molecular formula C15H17N7O2S and a molecular weight of 359.42 g/mol. Its IUPAC name is N-methyl-5-nitro-N-[(1-pyridazin-3-ylpyrrolidin-2-yl)methyl]imidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | N-methyl-5-nitro-N-[(1-pyridazin-3-ylpyrrolidin-2-yl)methyl]imidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 86902705 |
| Molecular Formula | C15H17N7O2S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | N-methyl-5-nitro-N-[(1-pyridazin-3-ylpyrrolidin-2-yl)methyl]imidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | CN(CC1CCCN1c1cccnn1)c1nc2sccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17N7O2S/c1-19(13-14(22(23)24)21-8-9-25-15(21)17-13)10-11-4-3-7-20(11)12-5-2-6-16-18-12/h2,5-6,8-9,11H,3-4,7,10H2,1H3 |
| InChIKey | XJXGXHJJWPXLDB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|