About 2-[cyclopentyl-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]acetic acid
2-[cyclopentyl-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]acetic acid (PubChem CID 60838498) has the molecular formula C12H14N4O4S
and a molecular weight of 310.34 g/mol. Its IUPAC name is 2-[cyclopentyl-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]acetic acid.
Molecular Properties
| Compound Name | 2-[cyclopentyl-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]acetic acid |
| PubChem CID | 60838498 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 2-[cyclopentyl-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]acetic acid |
| SMILES | O=C(O)CN(c1nc2sccn2c1[N+](=O)[O-])C1CCCC1 |
| InChI | InChI=1S/C12H14N4O4S/c17-9(18)7-15(8-3-1-2-4-8)10-11(16(19)20)14-5-6-21-12(14)13-10/h5-6,8H,1-4,7H2,(H,17,18) |
| InChIKey | FNHIOCIBKQYJCP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[cyclopentyl-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[cyclopentyl-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]acetic acid?
The IUPAC name of 2-[cyclopentyl-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]acetic acid (CID 60838498) is 2-[cyclopentyl-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]acetic acid.
What is the SMILES notation for 2-[cyclopentyl-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]acetic acid?
The canonical SMILES for 2-[cyclopentyl-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]acetic acid is O=C(O)CN(c1nc2sccn2c1[N+](=O)[O-])C1CCCC1.
What is the InChIKey of 2-[cyclopentyl-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]acetic acid?
The InChIKey is FNHIOCIBKQYJCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O4S/c17-9(18)7-15(8-3-1-2-4-8)10-11(16(19)20)14-5-6-21-12(14)13-10/h5-6,8H,1-4,7H2,(H,17,18).
What are the key properties of 2-[cyclopentyl-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]acetic acid?
2-[cyclopentyl-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]acetic acid has a molecular weight of 310.34 g/mol, XLogP of 2.14, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclopentyl-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]acetic acid is sourced from PubChem (CID 60838498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).