C11H16N4O3S — CID 107203480
5-[methyl-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]pentan-1-ol (PubChem CID 107203480) has the molecular formula C11H16N4O3S and a molecular weight of 284.34 g/mol. Its IUPAC name is 5-[methyl-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]pentan-1-ol.
| Compound Name | 5-[methyl-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 107203480 |
| Molecular Formula | C11H16N4O3S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 5-[methyl-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]pentan-1-ol |
| SMILES | CN(CCCCCO)c1nc2sccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16N4O3S/c1-13(5-3-2-4-7-16)9-10(15(17)18)14-6-8-19-11(14)12-9/h6,8,16H,2-5,7H2,1H3 |
| InChIKey | AUNLDSYATCXDGK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|