C13H10N4O3S2 — CID 18095387
N-[4-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylphenyl]acetamide (PubChem CID 18095387) has the molecular formula C13H10N4O3S2 and a molecular weight of 334.38 g/mol. Its IUPAC name is N-[4-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylphenyl]acetamide.
| Compound Name | N-[4-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 18095387 |
| Molecular Formula | C13H10N4O3S2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | N-[4-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Sc2nc3sccn3c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H10N4O3S2/c1-8(18)14-9-2-4-10(5-3-9)22-11-12(17(19)20)16-6-7-21-13(16)15-11/h2-7H,1H3,(H,14,18) |
| InChIKey | BURCISPFAFDDOJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|