C10H8N4O4S — CID 104571347
ethyl 2-cyano-2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)acetate (PubChem CID 104571347) has the molecular formula C10H8N4O4S and a molecular weight of 280.27 g/mol. Its IUPAC name is ethyl 2-cyano-2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)acetate.
| Compound Name | ethyl 2-cyano-2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)acetate |
|---|---|
| PubChem CID | 104571347 |
| Molecular Formula | C10H8N4O4S |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | ethyl 2-cyano-2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)acetate |
| SMILES | CCOC(=O)C(C#N)c1nc2sccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H8N4O4S/c1-2-18-9(15)6(5-11)7-8(14(16)17)13-3-4-19-10(13)12-7/h3-4,6H,2H2,1H3 |
| InChIKey | RMANSRFRWDFIJW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 110.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|